| Name | Methyl 4-benzyloxybenzoate |
| Synonyms | RARECHEM AL BF 0087 LABOTEST-BB LT00455680 METHYL 4-BENZYLOXYBENZOATE Methyl 4-benzyloxybenzoate METHYL 4-BENZYLOXYBENZONATE 2-methyl-4-phenylmethoxybenzoate 4-BENZYLOXYBENZOIC ACID METHYL ESTER 4-Benzyloxybenzoic acid methyl ester METHYL 4-(BENZYLOXY)BENZENECARBOXYLATE 4-Methylbenzoicacidbenzyloxygenradicals |
| CAS | 32122-11-5 |
| InChI | InChI=1/C15H14O3/c1-17-15(16)13-7-9-14(10-8-13)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| Molecular Formula | C15H14O3 |
| Molar Mass | 242.27 |
| Density | 1.142g/cm3 |
| Melting Point | 99°C |
| Boling Point | 372.5°C at 760 mmHg |
| Flash Point | 156.2°C |
| Vapor Presure | 9.56E-06mmHg at 25°C |
| Maximum wavelength(λmax) | 257nm(MeOH)(lit.) |
| BRN | 2119212 |
| Storage Condition | Room Temprature |
| Refractive Index | 1.566 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| UN IDs | 3077 |
| HS Code | 29420000 |